ChemNet > CAS > 78940-73-5 2-[(4-chlorophenyl)thio]-5-nitrobenzonitrile
78940-73-5 2-[(4-chlorophenyl)thio]-5-nitrobenzonitrile
produktnavn |
2-[(4-chlorophenyl)thio]-5-nitrobenzonitrile |
Engelsk navn |
2-[(4-chlorophenyl)thio]-5-nitrobenzonitrile;2-[(4-chlorophenyl)sulfanyl]-5-nitrobenzonitrile |
Molekylær Formel |
C13H7ClN2O2S |
Molekylvekt |
290.7249 |
InChI |
InChI=1/C13H7ClN2O2S/c14-10-1-4-12(5-2-10)19-13-6-3-11(16(17)18)7-9(13)8-15/h1-7H |
CAS-nummer |
78940-73-5 |
Molecular Structure |
|
Tetthet |
1.47g/cm3 |
Smeltepunkt |
167℃ |
Kokepunkt |
452.8°C at 760 mmHg |
Brytningsindeks |
1.685 |
Flammepunktet |
227.6°C |
Damptrykk |
2.18E-08mmHg at 25°C |
Hazard symboler |
Xn:Harmful;
|
Risiko Koder |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Sikkerhet Beskrivelse |
S36/37:Wear suitable protective clothing and gloves.;
|
|